C17H16Cl2N2O6 — CID 170692748
(1S,4R)-4-[[4-[(3,5-dichlorophenyl)carbamoyl]-1,3-dioxolane-4-carbonyl]amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 170692748) has the molecular formula C17H16Cl2N2O6 and a molecular weight of 415.23 g/mol. Its IUPAC name is (1S,4R)-4-[[4-[(3,5-dichlorophenyl)carbamoyl]-1,3-dioxolane-4-carbonyl]amino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | (1S,4R)-4-[[4-[(3,5-dichlorophenyl)carbamoyl]-1,3-dioxolane-4-carbonyl]amino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 170692748 |
| Molecular Formula | C17H16Cl2N2O6 |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | (1S,4R)-4-[[4-[(3,5-dichlorophenyl)carbamoyl]-1,3-dioxolane-4-carbonyl]amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C=C[C@H](NC(=O)C2(C(=O)Nc3cc(Cl)cc(Cl)c3)COCO2)C1 |
| InChI | InChI=1S/C17H16Cl2N2O6/c18-10-4-11(19)6-13(5-10)21-16(25)17(7-26-8-27-17)15(24)20-12-2-1-9(3-12)14(22)23/h1-2,4-6,9,12H,3,7-8H2,(H,20,24)(H,21,25)(H,22,23)/t9-,12+,17?/m1/s1 |
| InChIKey | CGBRLKZQJXCXCC-REAMZROGSA-N |
| XLogP | 1.82 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|