About 1-(5-bromoindol-1-yl)-N,N-dimethylethanamine
1-(5-bromoindol-1-yl)-N,N-dimethylethanamine (PubChem CID 170693260) has the molecular formula C12H15BrN2
and a molecular weight of 267.17 g/mol. Its IUPAC name is 1-(5-bromoindol-1-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 1-(5-bromoindol-1-yl)-N,N-dimethylethanamine |
| PubChem CID | 170693260 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 1-(5-bromoindol-1-yl)-N,N-dimethylethanamine |
| SMILES | CC(N(C)C)n1ccc2cc(Br)ccc21 |
| InChI | InChI=1S/C12H15BrN2/c1-9(14(2)3)15-7-6-10-8-11(13)4-5-12(10)15/h4-9H,1-3H3 |
| InChIKey | QSCVTZIMXRCMDU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-bromoindol-1-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromoindol-1-yl)-N,N-dimethylethanamine?
The IUPAC name of 1-(5-bromoindol-1-yl)-N,N-dimethylethanamine (CID 170693260) is 1-(5-bromoindol-1-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 1-(5-bromoindol-1-yl)-N,N-dimethylethanamine?
The canonical SMILES for 1-(5-bromoindol-1-yl)-N,N-dimethylethanamine is CC(N(C)C)n1ccc2cc(Br)ccc21.
What is the InChIKey of 1-(5-bromoindol-1-yl)-N,N-dimethylethanamine?
The InChIKey is QSCVTZIMXRCMDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrN2/c1-9(14(2)3)15-7-6-10-8-11(13)4-5-12(10)15/h4-9H,1-3H3.
What are the key properties of 1-(5-bromoindol-1-yl)-N,N-dimethylethanamine?
1-(5-bromoindol-1-yl)-N,N-dimethylethanamine has a molecular weight of 267.17 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromoindol-1-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 170693260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).