About trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate
trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate (PubChem CID 170693888) has the molecular formula C10H10ClNO2
and a molecular weight of 211.65 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate |
| PubChem CID | 170693888 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]1c1cc(Cl)ccn1 |
| InChI | InChI=1S/C10H10ClNO2/c1-14-10(13)8-5-7(8)9-4-6(11)2-3-12-9/h2-4,7-8H,5H2,1H3/t7-,8-/m0/s1 |
| InChIKey | PKVDWVMJLHPIRH-YUMQZZPRSA-N |
| XLogP | 2.01 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate?
The IUPAC name of trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate (CID 170693888) is trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate.
What is the SMILES notation for trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate?
The canonical SMILES for trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate is COC(=O)[C@H]1C[C@@H]1c1cc(Cl)ccn1.
What is the InChIKey of trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate?
The InChIKey is PKVDWVMJLHPIRH-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H10ClNO2/c1-14-10(13)8-5-7(8)9-4-6(11)2-3-12-9/h2-4,7-8H,5H2,1H3/t7-,8-/m0/s1.
What are the key properties of trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate?
trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate has a molecular weight of 211.65 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1S,2S)-2-(4-chloro-2-pyridinyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 170693888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).