About 3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate
3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate (PubChem CID 170695885) has the molecular formula C19H19IN2O3
and a molecular weight of 450.28 g/mol. Its IUPAC name is 3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate.
Molecular Properties
| Compound Name | 3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate |
| PubChem CID | 170695885 |
| Molecular Formula | C19H19IN2O3 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate |
| SMILES | O=C(COc1nn(Cc2ccccc2)c2ccccc12)OCCCI |
| InChI | InChI=1S/C19H19IN2O3/c20-11-6-12-24-18(23)14-25-19-16-9-4-5-10-17(16)22(21-19)13-15-7-2-1-3-8-15/h1-5,7-10H,6,11-14H2 |
| InChIKey | YGDPHQOBNAPPLP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate?
The IUPAC name of 3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate (CID 170695885) is 3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate.
What is the SMILES notation for 3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate?
The canonical SMILES for 3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate is O=C(COc1nn(Cc2ccccc2)c2ccccc12)OCCCI.
What is the InChIKey of 3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate?
The InChIKey is YGDPHQOBNAPPLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19IN2O3/c20-11-6-12-24-18(23)14-25-19-16-9-4-5-10-17(16)22(21-19)13-15-7-2-1-3-8-15/h1-5,7-10H,6,11-14H2.
What are the key properties of 3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate?
3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate has a molecular weight of 450.28 g/mol, XLogP of 3.83, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodopropyl 2-(1-benzylindazol-3-yl)oxyacetate is sourced from PubChem (CID 170695885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).