About 4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one
4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 170696041) has the molecular formula C15H14F3NO4
and a molecular weight of 329.27 g/mol. Its IUPAC name is 4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one |
| PubChem CID | 170696041 |
| Molecular Formula | C15H14F3NO4 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CC1(C)COC(=O)N1C(=O)/C=C/c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H14F3NO4/c1-14(2)9-22-13(21)19(14)12(20)8-7-10-5-3-4-6-11(10)23-15(16,17)18/h3-8H,9H2,1-2H3/b8-7+ |
| InChIKey | UIHHSTHFIVUQKX-BQYQJAHWSA-N |
| XLogP | 3.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one?
The IUPAC name of 4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one (CID 170696041) is 4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one is CC1(C)COC(=O)N1C(=O)/C=C/c1ccccc1OC(F)(F)F.
What is the InChIKey of 4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one?
The InChIKey is UIHHSTHFIVUQKX-BQYQJAHWSA-N. The full InChI is InChI=1S/C15H14F3NO4/c1-14(2)9-22-13(21)19(14)12(20)8-7-10-5-3-4-6-11(10)23-15(16,17)18/h3-8H,9H2,1-2H3/b8-7+.
What are the key properties of 4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one?
4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one has a molecular weight of 329.27 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-3-[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 170696041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).