C12H8BrClN2O2 — CID 170697655
6-(5-bromo-4-chloro-3-pyridinyl)-2-methoxypyridine-3-carbaldehyde (PubChem CID 170697655) has the molecular formula C12H8BrClN2O2 and a molecular weight of 327.57 g/mol. Its IUPAC name is 6-(5-bromo-4-chloro-3-pyridinyl)-2-methoxypyridine-3-carbaldehyde.
| Compound Name | 6-(5-bromo-4-chloro-3-pyridinyl)-2-methoxypyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 170697655 |
| Molecular Formula | C12H8BrClN2O2 |
| Molecular Weight | 327.57 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | 6-(5-bromo-4-chloro-3-pyridinyl)-2-methoxypyridine-3-carbaldehyde |
| SMILES | COc1nc(-c2cncc(Br)c2Cl)ccc1C=O |
| InChI | InChI=1S/C12H8BrClN2O2/c1-18-12-7(6-17)2-3-10(16-12)8-4-15-5-9(13)11(8)14/h2-6H,1H3 |
| InChIKey | PMPYRHHSLHBGGN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|