About 1-hydrazinylidene-1,3-benzothiazole
1-hydrazinylidene-1,3-benzothiazole (PubChem CID 170698611) has the molecular formula C7H7N3S
and a molecular weight of 165.22 g/mol. Its IUPAC name is 1-hydrazinylidene-1,3-benzothiazole.
Molecular Properties
| Compound Name | 1-hydrazinylidene-1,3-benzothiazole |
| PubChem CID | 170698611 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 1-hydrazinylidene-1,3-benzothiazole |
| SMILES | NN=S1C=Nc2ccccc21 |
| InChI | InChI=1S/C7H7N3S/c8-10-11-5-9-6-3-1-2-4-7(6)11/h1-5H,8H2 |
| InChIKey | WEOFNQFRCCQHNW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hydrazinylidene-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydrazinylidene-1,3-benzothiazole?
The IUPAC name of 1-hydrazinylidene-1,3-benzothiazole (CID 170698611) is 1-hydrazinylidene-1,3-benzothiazole.
What is the SMILES notation for 1-hydrazinylidene-1,3-benzothiazole?
The canonical SMILES for 1-hydrazinylidene-1,3-benzothiazole is NN=S1C=Nc2ccccc21.
What is the InChIKey of 1-hydrazinylidene-1,3-benzothiazole?
The InChIKey is WEOFNQFRCCQHNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S/c8-10-11-5-9-6-3-1-2-4-7(6)11/h1-5H,8H2.
What are the key properties of 1-hydrazinylidene-1,3-benzothiazole?
1-hydrazinylidene-1,3-benzothiazole has a molecular weight of 165.22 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydrazinylidene-1,3-benzothiazole is sourced from PubChem (CID 170698611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).