C18H17ClFN3O — CID 170699040
3-[2-(4-chloro-1-methylpyrazol-5-yl)-2-[(4-fluorophenyl)methoxy]ethyl]pyridine (PubChem CID 170699040) has the molecular formula C18H17ClFN3O and a molecular weight of 345.81 g/mol. Its IUPAC name is 3-[2-(4-chloro-1-methylpyrazol-5-yl)-2-[(4-fluorophenyl)methoxy]ethyl]pyridine.
| Compound Name | 3-[2-(4-chloro-1-methylpyrazol-5-yl)-2-[(4-fluorophenyl)methoxy]ethyl]pyridine |
|---|---|
| PubChem CID | 170699040 |
| Molecular Formula | C18H17ClFN3O |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3-[2-(4-chloro-1-methylpyrazol-5-yl)-2-[(4-fluorophenyl)methoxy]ethyl]pyridine |
| SMILES | Cn1ncc(Cl)c1C(Cc1cccnc1)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17ClFN3O/c1-23-18(16(19)11-22-23)17(9-14-3-2-8-21-10-14)24-12-13-4-6-15(20)7-5-13/h2-8,10-11,17H,9,12H2,1H3 |
| InChIKey | GAGLIROZERXJNU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |