C26H23Cl2N5O2 — CID 170699477
N-[6-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]-2-methyl-1,3-dihydroisoindol-5-yl]prop-2-enamide (PubChem CID 170699477) has the molecular formula C26H23Cl2N5O2 and a molecular weight of 508.41 g/mol. Its IUPAC name is N-[6-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]-2-methyl-1,3-dihydroisoindol-5-yl]prop-2-enamide.
| Compound Name | N-[6-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]-2-methyl-1,3-dihydroisoindol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170699477 |
| Molecular Formula | C26H23Cl2N5O2 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | N-[6-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]-2-methyl-1,3-dihydroisoindol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(cc1-c1n[nH]c3ccc(O[C@H](C)c4c(Cl)cncc4Cl)cc13)CN(C)C2 |
| InChI | InChI=1S/C26H23Cl2N5O2/c1-4-24(34)30-23-8-16-13-33(3)12-15(16)7-18(23)26-19-9-17(5-6-22(19)31-32-26)35-14(2)25-20(27)10-29-11-21(25)28/h4-11,14H,1,12-13H2,2-3H3,(H,30,34)(H,31,32)/t14-/m1/s1 |
| InChIKey | NZCXHFAGQQNRLF-CQSZACIVSA-N |
| XLogP | 6.14 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|