C12H22O3 — CID 170700246
(2,2-dimethoxyspiro[3.5]nonan-7-yl)methanol (PubChem CID 170700246) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (2,2-dimethoxyspiro[3.5]nonan-7-yl)methanol.
| Compound Name | (2,2-dimethoxyspiro[3.5]nonan-7-yl)methanol |
|---|---|
| PubChem CID | 170700246 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (2,2-dimethoxyspiro[3.5]nonan-7-yl)methanol |
| SMILES | COC1(OC)CC2(CCC(CO)CC2)C1 |
| InChI | InChI=1S/C12H22O3/c1-14-12(15-2)8-11(9-12)5-3-10(7-13)4-6-11/h10,13H,3-9H2,1-2H3 |
| InChIKey | SMSFEUJGLQFJEY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|