C16H18N4O4 — CID 170700896
5-[(Z)-[(Z)-(4-carboxy-3,5-dimethyl-1H-pyrrol-2-yl)methylidenehydrazinylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid (PubChem CID 170700896) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 5-[(Z)-[(Z)-(4-carboxy-3,5-dimethyl-1H-pyrrol-2-yl)methylidenehydrazinylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 5-[(Z)-[(Z)-(4-carboxy-3,5-dimethyl-1H-pyrrol-2-yl)methylidenehydrazinylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 170700896 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 5-[(Z)-[(Z)-(4-carboxy-3,5-dimethyl-1H-pyrrol-2-yl)methylidenehydrazinylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]c(/C=N\N=C/c2[nH]c(C)c(C(=O)O)c2C)c(C)c1C(=O)O |
| InChI | InChI=1S/C16H18N4O4/c1-7-11(19-9(3)13(7)15(21)22)5-17-18-6-12-8(2)14(16(23)24)10(4)20-12/h5-6,19-20H,1-4H3,(H,21,22)(H,23,24)/b17-5-,18-6- |
| InChIKey | HGRJXDBTQZNHDQ-OYUQAUEZSA-N |
| XLogP | 2.43 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|