C21H16F4N2O2 — CID 170701239
N-ethyl-6-(3-fluorophenyl)-5-[4-(trifluoromethyl)phenoxy]pyridine-2-carboxamide (PubChem CID 170701239) has the molecular formula C21H16F4N2O2 and a molecular weight of 404.36 g/mol. Its IUPAC name is N-ethyl-6-(3-fluorophenyl)-5-[4-(trifluoromethyl)phenoxy]pyridine-2-carboxamide.
| Compound Name | N-ethyl-6-(3-fluorophenyl)-5-[4-(trifluoromethyl)phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170701239 |
| Molecular Formula | C21H16F4N2O2 |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-ethyl-6-(3-fluorophenyl)-5-[4-(trifluoromethyl)phenoxy]pyridine-2-carboxamide |
| SMILES | CCNC(=O)c1ccc(Oc2ccc(C(F)(F)F)cc2)c(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C21H16F4N2O2/c1-2-26-20(28)17-10-11-18(19(27-17)13-4-3-5-15(22)12-13)29-16-8-6-14(7-9-16)21(23,24)25/h3-12H,2H2,1H3,(H,26,28) |
| InChIKey | HKHBJRKFCCMELH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |