About CID 170701542
CID 170701542 (PubChem CID 170701542) has the molecular formula C14H18BBrN4O
and a molecular weight of 349.04 g/mol.
Molecular Properties
| Compound Name | CID 170701542 |
| PubChem CID | 170701542 |
| Molecular Formula | C14H18BBrN4O |
| Molecular Weight | 349.04 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | — |
| SMILES | [B]C1CC(Nc2nc(C=C)n(C=C)c(=O)c2Br)CN(C)C1 |
| InChI | InChI=1S/C14H18BBrN4O/c1-4-11-18-13(12(16)14(21)20(11)5-2)17-10-6-9(15)7-19(3)8-10/h4-5,9-10,17H,1-2,6-8H2,3H3 |
| InChIKey | PBMOWLRXSPWBHT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.04 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 170701542 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170701542?
The IUPAC name of CID 170701542 (CID 170701542) is not available.
What is the SMILES notation for CID 170701542?
The canonical SMILES for CID 170701542 is [B]C1CC(Nc2nc(C=C)n(C=C)c(=O)c2Br)CN(C)C1.
What is the InChIKey of CID 170701542?
The InChIKey is PBMOWLRXSPWBHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BBrN4O/c1-4-11-18-13(12(16)14(21)20(11)5-2)17-10-6-9(15)7-19(3)8-10/h4-5,9-10,17H,1-2,6-8H2,3H3.
What are the key properties of CID 170701542?
CID 170701542 has a molecular weight of 349.04 g/mol, XLogP of 1.82, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170701542 is sourced from PubChem (CID 170701542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).