C16H17FN2O4 — CID 170701593
4-(5-fluoro-5-methyl-1,3-dioxocyclohepta[c]pyrrol-2-yl)-N-formylpentanamide (PubChem CID 170701593) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is 4-(5-fluoro-5-methyl-1,3-dioxocyclohepta[c]pyrrol-2-yl)-N-formylpentanamide.
| Compound Name | 4-(5-fluoro-5-methyl-1,3-dioxocyclohepta[c]pyrrol-2-yl)-N-formylpentanamide |
|---|---|
| PubChem CID | 170701593 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4-(5-fluoro-5-methyl-1,3-dioxocyclohepta[c]pyrrol-2-yl)-N-formylpentanamide |
| SMILES | CC(CCC(=O)NC=O)N1C(=O)C2=CC=CC(C)(F)C=C2C1=O |
| InChI | InChI=1S/C16H17FN2O4/c1-10(5-6-13(21)18-9-20)19-14(22)11-4-3-7-16(2,17)8-12(11)15(19)23/h3-4,7-10H,5-6H2,1-2H3,(H,18,20,21) |
| InChIKey | PEZQFQWFFNYVES-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|