C16H22N6O — CID 170701640
4-(dimethylamino)-N-[(E)-N'-(4-methylquinazolin-2-yl)carbamimidoyl]butanamide (PubChem CID 170701640) has the molecular formula C16H22N6O and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[(E)-N'-(4-methylquinazolin-2-yl)carbamimidoyl]butanamide.
| Compound Name | 4-(dimethylamino)-N-[(E)-N'-(4-methylquinazolin-2-yl)carbamimidoyl]butanamide |
|---|---|
| PubChem CID | 170701640 |
| Molecular Formula | C16H22N6O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 4-(dimethylamino)-N-[(E)-N'-(4-methylquinazolin-2-yl)carbamimidoyl]butanamide |
| SMILES | Cc1nc(/N=C(\N)NC(=O)CCCN(C)C)nc2ccccc12 |
| InChI | InChI=1S/C16H22N6O/c1-11-12-7-4-5-8-13(12)19-16(18-11)21-15(17)20-14(23)9-6-10-22(2)3/h4-5,7-8H,6,9-10H2,1-3H3,(H3,17,18,19,20,21,23) |
| InChIKey | DCGYAQCHCFXGQY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|