C17H21N5O — CID 170701778
2-cyclopentyl-N-[(E)-N'-(4-methylquinazolin-2-yl)carbamimidoyl]acetamide (PubChem CID 170701778) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(E)-N'-(4-methylquinazolin-2-yl)carbamimidoyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[(E)-N'-(4-methylquinazolin-2-yl)carbamimidoyl]acetamide |
|---|---|
| PubChem CID | 170701778 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-cyclopentyl-N-[(E)-N'-(4-methylquinazolin-2-yl)carbamimidoyl]acetamide |
| SMILES | Cc1nc(/N=C(\N)NC(=O)CC2CCCC2)nc2ccccc12 |
| InChI | InChI=1S/C17H21N5O/c1-11-13-8-4-5-9-14(13)20-17(19-11)22-16(18)21-15(23)10-12-6-2-3-7-12/h4-5,8-9,12H,2-3,6-7,10H2,1H3,(H3,18,19,20,21,22,23) |
| InChIKey | URMIUJLAHMBKFR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|