C22H17N7O3 — CID 170702510
N-[3-methyl-4-(1H-pyrido[2,1-f][1,2,4]triazin-6-yloxy)phenyl]-6-nitroquinazolin-4-amine (PubChem CID 170702510) has the molecular formula C22H17N7O3 and a molecular weight of 427.42 g/mol. Its IUPAC name is N-[3-methyl-4-(1H-pyrido[2,1-f][1,2,4]triazin-6-yloxy)phenyl]-6-nitroquinazolin-4-amine.
| Compound Name | N-[3-methyl-4-(1H-pyrido[2,1-f][1,2,4]triazin-6-yloxy)phenyl]-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 170702510 |
| Molecular Formula | C22H17N7O3 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-[3-methyl-4-(1H-pyrido[2,1-f][1,2,4]triazin-6-yloxy)phenyl]-6-nitroquinazolin-4-amine |
| SMILES | Cc1cc(Nc2ncnc3ccc([N+](=O)[O-])cc23)ccc1OC1=CC2=CN=CNN2C=C1 |
| InChI | InChI=1S/C22H17N7O3/c1-14-8-15(27-22-19-10-16(29(30)31)3-4-20(19)24-13-25-22)2-5-21(14)32-18-6-7-28-17(9-18)11-23-12-26-28/h2-13H,1H3,(H,23,26)(H,24,25,27) |
| InChIKey | PGVCVRYZYUDBIQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|