C18H18FN3O3 — CID 170702582
[(3R)-8-(3-fluorophenoxy)-1,7-dimethyl-2-oxo-3,4-dihydroquinolin-3-yl]urea (PubChem CID 170702582) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is [(3R)-8-(3-fluorophenoxy)-1,7-dimethyl-2-oxo-3,4-dihydroquinolin-3-yl]urea.
| Compound Name | [(3R)-8-(3-fluorophenoxy)-1,7-dimethyl-2-oxo-3,4-dihydroquinolin-3-yl]urea |
|---|---|
| PubChem CID | 170702582 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | [(3R)-8-(3-fluorophenoxy)-1,7-dimethyl-2-oxo-3,4-dihydroquinolin-3-yl]urea |
| SMILES | Cc1ccc2c(c1Oc1cccc(F)c1)N(C)C(=O)[C@H](NC(N)=O)C2 |
| InChI | InChI=1S/C18H18FN3O3/c1-10-6-7-11-8-14(21-18(20)24)17(23)22(2)15(11)16(10)25-13-5-3-4-12(19)9-13/h3-7,9,14H,8H2,1-2H3,(H3,20,21,24)/t14-/m1/s1 |
| InChIKey | AOFKPISUDXFLDU-CQSZACIVSA-N |
| XLogP | 2.48 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |