About 6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline
6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline (PubChem CID 170702602) has the molecular formula C15H14BrClFN
and a molecular weight of 342.64 g/mol. Its IUPAC name is 6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline.
Molecular Properties
| Compound Name | 6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline |
| PubChem CID | 170702602 |
| Molecular Formula | C15H14BrClFN |
| Molecular Weight | 342.64 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline |
| SMILES | CNc1c(Br)ccc(C)c1Cc1cc(F)ccc1Cl |
| InChI | InChI=1S/C15H14BrClFN/c1-9-3-5-13(16)15(19-2)12(9)8-10-7-11(18)4-6-14(10)17/h3-7,19H,8H2,1-2H3 |
| InChIKey | ZXKSQUYOIBLYPF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline?
The IUPAC name of 6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline (CID 170702602) is 6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline.
What is the SMILES notation for 6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline?
The canonical SMILES for 6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline is CNc1c(Br)ccc(C)c1Cc1cc(F)ccc1Cl.
What is the InChIKey of 6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline?
The InChIKey is ZXKSQUYOIBLYPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrClFN/c1-9-3-5-13(16)15(19-2)12(9)8-10-7-11(18)4-6-14(10)17/h3-7,19H,8H2,1-2H3.
What are the key properties of 6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline?
6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline has a molecular weight of 342.64 g/mol, XLogP of 5.18, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-[(2-chloro-5-fluorophenyl)methyl]-N,3-dimethylaniline is sourced from PubChem (CID 170702602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).