C24H28F12N2O4Si2 — CID 170703042
N-[3-[[2-[3-[bis(2,2,2-trifluoroacetyl)amino]propyl-dimethylsilyl]phenyl]-dimethylsilyl]propyl]-2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)acetamide (PubChem CID 170703042) has the molecular formula C24H28F12N2O4Si2 and a molecular weight of 692.65 g/mol. Its IUPAC name is N-[3-[[2-[3-[bis(2,2,2-trifluoroacetyl)amino]propyl-dimethylsilyl]phenyl]-dimethylsilyl]propyl]-2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)acetamide.
| Compound Name | N-[3-[[2-[3-[bis(2,2,2-trifluoroacetyl)amino]propyl-dimethylsilyl]phenyl]-dimethylsilyl]propyl]-2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)acetamide |
|---|---|
| PubChem CID | 170703042 |
| Molecular Formula | C24H28F12N2O4Si2 |
| Molecular Weight | 692.65 g/mol |
| Exact Mass | 692.14 |
| IUPAC Name | N-[3-[[2-[3-[bis(2,2,2-trifluoroacetyl)amino]propyl-dimethylsilyl]phenyl]-dimethylsilyl]propyl]-2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)acetamide |
| SMILES | C[Si](C)(CCCN(C(=O)C(F)(F)F)C(=O)C(F)(F)F)c1ccccc1[Si](C)(C)CCCN(C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C24H28F12N2O4Si2/c1-43(2,13-7-11-37(17(39)21(25,26)27)18(40)22(28,29)30)15-9-5-6-10-16(15)44(3,4)14-8-12-38(19(41)23(31,32)33)20(42)24(34,35)36/h5-6,9-10H,7-8,11-14H2,1-4H3 |
| InChIKey | BFLUIACEGYZKGT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.65 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|