C18H14IN3O — CID 170703629
(E)-1-[6-(1H-indazol-3-yl)-2,3-dihydroindol-1-yl]-3-iodoprop-2-en-1-one (PubChem CID 170703629) has the molecular formula C18H14IN3O and a molecular weight of 415.23 g/mol. Its IUPAC name is (E)-1-[6-(1H-indazol-3-yl)-2,3-dihydroindol-1-yl]-3-iodoprop-2-en-1-one.
| Compound Name | (E)-1-[6-(1H-indazol-3-yl)-2,3-dihydroindol-1-yl]-3-iodoprop-2-en-1-one |
|---|---|
| PubChem CID | 170703629 |
| Molecular Formula | C18H14IN3O |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | (E)-1-[6-(1H-indazol-3-yl)-2,3-dihydroindol-1-yl]-3-iodoprop-2-en-1-one |
| SMILES | O=C(/C=C/I)N1CCc2ccc(-c3n[nH]c4ccccc34)cc21 |
| InChI | InChI=1S/C18H14IN3O/c19-9-7-17(23)22-10-8-12-5-6-13(11-16(12)22)18-14-3-1-2-4-15(14)20-21-18/h1-7,9,11H,8,10H2,(H,20,21)/b9-7+ |
| InChIKey | XLLBDDJKJQGGCK-VQHVLOKHSA-N |
| XLogP | 4.07 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|