C28H40FN3O3 — CID 170703778
N-[(2E,4E,6Z)-2,5-bis(ethenyl)-6-methylocta-2,4,6-trienyl]-1-[2-[(1-fluorocyclopropanecarbonyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide (PubChem CID 170703778) has the molecular formula C28H40FN3O3 and a molecular weight of 485.64 g/mol. Its IUPAC name is N-[(2E,4E,6Z)-2,5-bis(ethenyl)-6-methylocta-2,4,6-trienyl]-1-[2-[(1-fluorocyclopropanecarbonyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(2E,4E,6Z)-2,5-bis(ethenyl)-6-methylocta-2,4,6-trienyl]-1-[2-[(1-fluorocyclopropanecarbonyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170703778 |
| Molecular Formula | C28H40FN3O3 |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | N-[(2E,4E,6Z)-2,5-bis(ethenyl)-6-methylocta-2,4,6-trienyl]-1-[2-[(1-fluorocyclopropanecarbonyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide |
| SMILES | C=C/C(=C\C=C(C=C)\C(C)=C/C)CNC(=O)C1CCCN1C(=O)C(NC(=O)C1(F)CC1)C(C)(C)C |
| InChI | InChI=1S/C28H40FN3O3/c1-8-19(4)21(10-3)14-13-20(9-2)18-30-24(33)22-12-11-17-32(22)25(34)23(27(5,6)7)31-26(35)28(29)15-16-28/h8-10,13-14,22-23H,2-3,11-12,15-18H2,1,4-7H3,(H,30,33)(H,31,35)/b19-8-,20-13+,21-14+ |
| InChIKey | RKCUCLYCENUDOY-USNRBSHJSA-N |
| XLogP | 4.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|