C36H40N6O5 — CID 170703843
1-[[4-[6-[[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]amino]hexylamino]phenyl]methyl]indole-6-carboxamide (PubChem CID 170703843) has the molecular formula C36H40N6O5 and a molecular weight of 636.75 g/mol. Its IUPAC name is 1-[[4-[6-[[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]amino]hexylamino]phenyl]methyl]indole-6-carboxamide.
| Compound Name | 1-[[4-[6-[[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]amino]hexylamino]phenyl]methyl]indole-6-carboxamide |
|---|---|
| PubChem CID | 170703843 |
| Molecular Formula | C36H40N6O5 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.31 |
| IUPAC Name | 1-[[4-[6-[[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]amino]hexylamino]phenyl]methyl]indole-6-carboxamide |
| SMILES | CNC(=O)CCC(C=O)N1C(=O)c2cccc(NCCCCCCNc3ccc(Cn4ccc5ccc(C(N)=O)cc54)cc3)c2C1=O |
| InChI | InChI=1S/C36H40N6O5/c1-38-32(44)16-15-28(23-43)42-35(46)29-7-6-8-30(33(29)36(42)47)40-19-5-3-2-4-18-39-27-13-9-24(10-14-27)22-41-20-17-25-11-12-26(34(37)45)21-31(25)41/h6-14,17,20-21,23,28,39-40H,2-5,15-16,18-19,22H2,1H3,(H2,37,45)(H,38,44) |
| InChIKey | JILWGYKECFBQRK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 155.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|