C17H25N5O2 — CID 170704885
1-ethyl-2-[[4-[4-(oxan-2-yloxymethyl)triazol-1-yl]phenyl]methyl]hydrazine (PubChem CID 170704885) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-ethyl-2-[[4-[4-(oxan-2-yloxymethyl)triazol-1-yl]phenyl]methyl]hydrazine.
| Compound Name | 1-ethyl-2-[[4-[4-(oxan-2-yloxymethyl)triazol-1-yl]phenyl]methyl]hydrazine |
|---|---|
| PubChem CID | 170704885 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 1-ethyl-2-[[4-[4-(oxan-2-yloxymethyl)triazol-1-yl]phenyl]methyl]hydrazine |
| SMILES | CCNNCc1ccc(-n2cc(COC3CCCCO3)nn2)cc1 |
| InChI | InChI=1S/C17H25N5O2/c1-2-18-19-11-14-6-8-16(9-7-14)22-12-15(20-21-22)13-24-17-5-3-4-10-23-17/h6-9,12,17-19H,2-5,10-11,13H2,1H3 |
| InChIKey | WGQPUUWXHSHQEL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 73.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|