About CID 170705046
CID 170705046 (PubChem CID 170705046) has the molecular formula C16H32BN5O3S
and a molecular weight of 385.34 g/mol.
Molecular Properties
| Compound Name | CID 170705046 |
| PubChem CID | 170705046 |
| Molecular Formula | C16H32BN5O3S |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | — |
| SMILES | CC.[B]c1c(CN2CCS(=O)CC2)nnn1CCOCCOCCNC |
| InChI | InChI=1S/C14H26BN5O3S.C2H6/c1-16-2-6-22-8-9-23-7-3-20-14(15)13(17-18-20)12-19-4-10-24(21)11-5-19;1-2/h16H,2-12H2,1H3;1-2H3 |
| InChIKey | XKCZHZMLWCROQS-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 170705046 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170705046?
The IUPAC name of CID 170705046 (CID 170705046) is not available.
What is the SMILES notation for CID 170705046?
The canonical SMILES for CID 170705046 is CC.[B]c1c(CN2CCS(=O)CC2)nnn1CCOCCOCCNC.
What is the InChIKey of CID 170705046?
The InChIKey is XKCZHZMLWCROQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26BN5O3S.C2H6/c1-16-2-6-22-8-9-23-7-3-20-14(15)13(17-18-20)12-19-4-10-24(21)11-5-19;1-2/h16H,2-12H2,1H3;1-2H3.
What are the key properties of CID 170705046?
CID 170705046 has a molecular weight of 385.34 g/mol, XLogP of -1.09, 11 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170705046 is sourced from PubChem (CID 170705046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).