C15H20N2O5 — CID 170705296
(2Z)-2-ethenyl-3-formyl-4-hydroxy-N-methyl-N-[5-(methylamino)-1,5-dioxopentan-2-yl]penta-2,4-dienamide (PubChem CID 170705296) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is (2Z)-2-ethenyl-3-formyl-4-hydroxy-N-methyl-N-[5-(methylamino)-1,5-dioxopentan-2-yl]penta-2,4-dienamide.
| Compound Name | (2Z)-2-ethenyl-3-formyl-4-hydroxy-N-methyl-N-[5-(methylamino)-1,5-dioxopentan-2-yl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 170705296 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (2Z)-2-ethenyl-3-formyl-4-hydroxy-N-methyl-N-[5-(methylamino)-1,5-dioxopentan-2-yl]penta-2,4-dienamide |
| SMILES | C=C/C(C(=O)N(C)C(C=O)CCC(=O)NC)=C(/C=O)C(=C)O |
| InChI | InChI=1S/C15H20N2O5/c1-5-12(13(9-19)10(2)20)15(22)17(4)11(8-18)6-7-14(21)16-3/h5,8-9,11,20H,1-2,6-7H2,3-4H3,(H,16,21)/b13-12+ |
| InChIKey | HWMJORTYFAINMZ-OUKQBFOZSA-N |
| XLogP | 0.29 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|