C29H32FNO4 — CID 170706021
(3R,4R)-4-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2-fluorophenyl]-3-phenyl-3,4-dihydro-1H-isochromen-7-ol (PubChem CID 170706021) has the molecular formula C29H32FNO4 and a molecular weight of 477.58 g/mol. Its IUPAC name is (3R,4R)-4-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2-fluorophenyl]-3-phenyl-3,4-dihydro-1H-isochromen-7-ol.
| Compound Name | (3R,4R)-4-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2-fluorophenyl]-3-phenyl-3,4-dihydro-1H-isochromen-7-ol |
|---|---|
| PubChem CID | 170706021 |
| Molecular Formula | C29H32FNO4 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | (3R,4R)-4-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2-fluorophenyl]-3-phenyl-3,4-dihydro-1H-isochromen-7-ol |
| SMILES | COC(OC)C1CCN(c2ccc([C@H]3c4ccc(O)cc4CO[C@H]3c3ccccc3)c(F)c2)CC1 |
| InChI | InChI=1S/C29H32FNO4/c1-33-29(34-2)20-12-14-31(15-13-20)22-8-10-25(26(30)17-22)27-24-11-9-23(32)16-21(24)18-35-28(27)19-6-4-3-5-7-19/h3-11,16-17,20,27-29,32H,12-15,18H2,1-2H3/t27-,28+/m1/s1 |
| InChIKey | YCGRNEDKWIAHQX-IZLXSDGUSA-N |
| XLogP | 5.77 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|