C32H39NO3 — CID 170706130
4-(dimethoxymethyl)-1-[4-[(1S,2R,3S)-6-methoxy-3-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine (PubChem CID 170706130) has the molecular formula C32H39NO3 and a molecular weight of 485.67 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-1-[4-[(1S,2R,3S)-6-methoxy-3-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine.
| Compound Name | 4-(dimethoxymethyl)-1-[4-[(1S,2R,3S)-6-methoxy-3-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine |
|---|---|
| PubChem CID | 170706130 |
| Molecular Formula | C32H39NO3 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | 4-(dimethoxymethyl)-1-[4-[(1S,2R,3S)-6-methoxy-3-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine |
| SMILES | COc1ccc2c(c1)C[C@H](C)[C@@H](c1ccccc1)[C@H]2c1ccc(N2CCC(C(OC)OC)CC2)cc1 |
| InChI | InChI=1S/C32H39NO3/c1-22-20-26-21-28(34-2)14-15-29(26)31(30(22)23-8-6-5-7-9-23)24-10-12-27(13-11-24)33-18-16-25(17-19-33)32(35-3)36-4/h5-15,21-22,25,30-32H,16-20H2,1-4H3/t22-,30-,31-/m0/s1 |
| InChIKey | KKRMAVUTNMCTFD-QDSNVRCDSA-N |
| XLogP | 6.64 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|