C30H34F2N2O4 — CID 170706427
1-[5-[4-(dimethoxymethyl)piperidin-1-yl]-2-pyridinyl]-4,4-difluoro-6-phenylmethoxy-2,3-dihydronaphthalen-1-ol (PubChem CID 170706427) has the molecular formula C30H34F2N2O4 and a molecular weight of 524.61 g/mol. Its IUPAC name is 1-[5-[4-(dimethoxymethyl)piperidin-1-yl]-2-pyridinyl]-4,4-difluoro-6-phenylmethoxy-2,3-dihydronaphthalen-1-ol.
| Compound Name | 1-[5-[4-(dimethoxymethyl)piperidin-1-yl]-2-pyridinyl]-4,4-difluoro-6-phenylmethoxy-2,3-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 170706427 |
| Molecular Formula | C30H34F2N2O4 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 1-[5-[4-(dimethoxymethyl)piperidin-1-yl]-2-pyridinyl]-4,4-difluoro-6-phenylmethoxy-2,3-dihydronaphthalen-1-ol |
| SMILES | COC(OC)C1CCN(c2ccc(C3(O)CCC(F)(F)c4cc(OCc5ccccc5)ccc43)nc2)CC1 |
| InChI | InChI=1S/C30H34F2N2O4/c1-36-28(37-2)22-12-16-34(17-13-22)23-8-11-27(33-19-23)29(35)14-15-30(31,32)26-18-24(9-10-25(26)29)38-20-21-6-4-3-5-7-21/h3-11,18-19,22,28,35H,12-17,20H2,1-2H3 |
| InChIKey | HQDUGMJTHAQDFN-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 64.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|