C30H41NO4 — CID 170707135
(3S,4S)-3-cyclohexyl-4-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-3-methyl-1,4-dihydroisochromen-7-ol (PubChem CID 170707135) has the molecular formula C30H41NO4 and a molecular weight of 479.66 g/mol. Its IUPAC name is (3S,4S)-3-cyclohexyl-4-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-3-methyl-1,4-dihydroisochromen-7-ol.
| Compound Name | (3S,4S)-3-cyclohexyl-4-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-3-methyl-1,4-dihydroisochromen-7-ol |
|---|---|
| PubChem CID | 170707135 |
| Molecular Formula | C30H41NO4 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | (3S,4S)-3-cyclohexyl-4-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-3-methyl-1,4-dihydroisochromen-7-ol |
| SMILES | COC(OC)C1CCN(c2ccc([C@H]3c4ccc(O)cc4CO[C@@]3(C)C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C30H41NO4/c1-30(24-7-5-4-6-8-24)28(27-14-13-26(32)19-23(27)20-35-30)21-9-11-25(12-10-21)31-17-15-22(16-18-31)29(33-2)34-3/h9-14,19,22,24,28-29,32H,4-8,15-18,20H2,1-3H3/t28-,30-/m0/s1 |
| InChIKey | UXYYYIJHTALMOV-JDXGNMNLSA-N |
| XLogP | 6.23 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|