About N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine
N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine (PubChem CID 170707334) has the molecular formula C15H28F3N3
and a molecular weight of 307.40 g/mol. Its IUPAC name is N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine.
Molecular Properties
| Compound Name | N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine |
| PubChem CID | 170707334 |
| Molecular Formula | C15H28F3N3 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine |
| SMILES | CCCC1CCN(C(NCC(F)(F)F)N(C)C2CC2)CC1 |
| InChI | InChI=1S/C15H28F3N3/c1-3-4-12-7-9-21(10-8-12)14(19-11-15(16,17)18)20(2)13-5-6-13/h12-14,19H,3-11H2,1-2H3 |
| InChIKey | JNZKSDTUJZYCQS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine?
The IUPAC name of N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine (CID 170707334) is N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine.
What is the SMILES notation for N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine?
The canonical SMILES for N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine is CCCC1CCN(C(NCC(F)(F)F)N(C)C2CC2)CC1.
What is the InChIKey of N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine?
The InChIKey is JNZKSDTUJZYCQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28F3N3/c1-3-4-12-7-9-21(10-8-12)14(19-11-15(16,17)18)20(2)13-5-6-13/h12-14,19H,3-11H2,1-2H3.
What are the key properties of N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine?
N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine has a molecular weight of 307.40 g/mol, XLogP of 3.03, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopropyl-N'-methyl-1-(4-propylpiperidin-1-yl)-N-(2,2,2-trifluoroethyl)methanediamine is sourced from PubChem (CID 170707334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).