C12H12FNO — CID 170707361
[4-[(1E)-2-fluoro-1-(methylideneamino)buta-1,3-dienyl]phenyl]methanol (PubChem CID 170707361) has the molecular formula C12H12FNO and a molecular weight of 205.23 g/mol. Its IUPAC name is [4-[(1E)-2-fluoro-1-(methylideneamino)buta-1,3-dienyl]phenyl]methanol.
| Compound Name | [4-[(1E)-2-fluoro-1-(methylideneamino)buta-1,3-dienyl]phenyl]methanol |
|---|---|
| PubChem CID | 170707361 |
| Molecular Formula | C12H12FNO |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | [4-[(1E)-2-fluoro-1-(methylideneamino)buta-1,3-dienyl]phenyl]methanol |
| SMILES | C=C/C(F)=C(\N=C)c1ccc(CO)cc1 |
| InChI | InChI=1S/C12H12FNO/c1-3-11(13)12(14-2)10-6-4-9(8-15)5-7-10/h3-7,15H,1-2,8H2/b12-11+ |
| InChIKey | FWOZGYPRPQIMLN-VAWYXSNFSA-N |
| XLogP | 2.70 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|