C28H27FN4O4 — CID 170707761
3-[6-[(3S)-1-[(4-fluoro-2-methylquinolin-6-yl)methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170707761) has the molecular formula C28H27FN4O4 and a molecular weight of 502.55 g/mol. Its IUPAC name is 3-[6-[(3S)-1-[(4-fluoro-2-methylquinolin-6-yl)methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(3S)-1-[(4-fluoro-2-methylquinolin-6-yl)methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170707761 |
| Molecular Formula | C28H27FN4O4 |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 3-[6-[(3S)-1-[(4-fluoro-2-methylquinolin-6-yl)methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1cc(F)c2cc(CN3CC[C@H](Oc4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)C3)ccc2n1 |
| InChI | InChI=1S/C28H27FN4O4/c1-16-10-23(29)22-11-17(2-5-24(22)30-16)13-32-9-8-20(15-32)37-19-3-4-21-18(12-19)14-33(28(21)36)25-6-7-26(34)31-27(25)35/h2-5,10-12,20,25H,6-9,13-15H2,1H3,(H,31,34,35)/t20-,25?/m0/s1 |
| InChIKey | YKXFZVNJGWTXRN-JINQPTGOSA-N |
| XLogP | 3.10 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|