C28H25F3N4O4 — CID 170707805
3-[3-oxo-6-[(3S)-1-[[3-(trifluoromethyl)quinolin-6-yl]methyl]pyrrolidin-3-yl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170707805) has the molecular formula C28H25F3N4O4 and a molecular weight of 538.53 g/mol. Its IUPAC name is 3-[3-oxo-6-[(3S)-1-[[3-(trifluoromethyl)quinolin-6-yl]methyl]pyrrolidin-3-yl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[(3S)-1-[[3-(trifluoromethyl)quinolin-6-yl]methyl]pyrrolidin-3-yl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170707805 |
| Molecular Formula | C28H25F3N4O4 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 3-[3-oxo-6-[(3S)-1-[[3-(trifluoromethyl)quinolin-6-yl]methyl]pyrrolidin-3-yl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@H]4CCN(Cc5ccc6ncc(C(F)(F)F)cc6c5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H25F3N4O4/c29-28(30,31)19-10-17-9-16(1-4-23(17)32-12-19)13-34-8-7-21(15-34)39-20-2-3-22-18(11-20)14-35(27(22)38)24-5-6-25(36)33-26(24)37/h1-4,9-12,21,24H,5-8,13-15H2,(H,33,36,37)/t21-,24?/m0/s1 |
| InChIKey | HKPIDWAGDRQTBK-XEGCMXMBSA-N |
| XLogP | 3.67 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|