C15H17BrN2O — CID 170707974
6-bromo-2-(2,2-dimethyloxan-4-yl)quinazoline (PubChem CID 170707974) has the molecular formula C15H17BrN2O and a molecular weight of 321.22 g/mol. Its IUPAC name is 6-bromo-2-(2,2-dimethyloxan-4-yl)quinazoline.
| Compound Name | 6-bromo-2-(2,2-dimethyloxan-4-yl)quinazoline |
|---|---|
| PubChem CID | 170707974 |
| Molecular Formula | C15H17BrN2O |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 6-bromo-2-(2,2-dimethyloxan-4-yl)quinazoline |
| SMILES | CC1(C)CC(c2ncc3cc(Br)ccc3n2)CCO1 |
| InChI | InChI=1S/C15H17BrN2O/c1-15(2)8-10(5-6-19-15)14-17-9-11-7-12(16)3-4-13(11)18-14/h3-4,7,9-10H,5-6,8H2,1-2H3 |
| InChIKey | NVAJUYYDWYNLBY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |