About 5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide
5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 170709238) has the molecular formula C10H18F2N2O
and a molecular weight of 220.26 g/mol. Its IUPAC name is 5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide |
| PubChem CID | 170709238 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC(C)NC(=O)C1CC(N)CC(F)(F)C1 |
| InChI | InChI=1S/C10H18F2N2O/c1-6(2)14-9(15)7-3-8(13)5-10(11,12)4-7/h6-8H,3-5,13H2,1-2H3,(H,14,15) |
| InChIKey | NAVNANLIRUMWIW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide?
The IUPAC name of 5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide (CID 170709238) is 5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide.
What is the SMILES notation for 5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide?
The canonical SMILES for 5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide is CC(C)NC(=O)C1CC(N)CC(F)(F)C1.
What is the InChIKey of 5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide?
The InChIKey is NAVNANLIRUMWIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O/c1-6(2)14-9(15)7-3-8(13)5-10(11,12)4-7/h6-8H,3-5,13H2,1-2H3,(H,14,15).
What are the key properties of 5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide?
5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide has a molecular weight of 220.26 g/mol, XLogP of 1.27, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3,3-difluoro-N-propan-2-ylcyclohexane-1-carboxamide is sourced from PubChem (CID 170709238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).