About (4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine
(4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine (PubChem CID 170709406) has the molecular formula C11H10F5NO2
and a molecular weight of 283.20 g/mol. Its IUPAC name is (4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine.
Molecular Properties
| Compound Name | (4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine |
| PubChem CID | 170709406 |
| Molecular Formula | C11H10F5NO2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine |
| SMILES | Fc1ccc(O[C@H]2CNCC2(F)F)cc1OC(F)F |
| InChI | InChI=1S/C11H10F5NO2/c12-7-2-1-6(3-8(7)19-10(13)14)18-9-4-17-5-11(9,15)16/h1-3,9-10,17H,4-5H2/t9-/m0/s1 |
| InChIKey | AINCIPSRJMZZEJ-VIFPVBQESA-N |
| XLogP | 2.41 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine?
The IUPAC name of (4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine (CID 170709406) is (4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine.
What is the SMILES notation for (4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine?
The canonical SMILES for (4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine is Fc1ccc(O[C@H]2CNCC2(F)F)cc1OC(F)F.
What is the InChIKey of (4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine?
The InChIKey is AINCIPSRJMZZEJ-VIFPVBQESA-N. The full InChI is InChI=1S/C11H10F5NO2/c12-7-2-1-6(3-8(7)19-10(13)14)18-9-4-17-5-11(9,15)16/h1-3,9-10,17H,4-5H2/t9-/m0/s1.
What are the key properties of (4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine?
(4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine has a molecular weight of 283.20 g/mol, XLogP of 2.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[3-(difluoromethoxy)-4-fluorophenoxy]-3,3-difluoropyrrolidine is sourced from PubChem (CID 170709406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).