C11H15NO10 — CID 170710318
1-(2,2-dihydroxy-1,3-benzodioxol-5-yl)-2-(trihydroxymethylamino)propane-1,1,2-triol (PubChem CID 170710318) has the molecular formula C11H15NO10 and a molecular weight of 321.24 g/mol. Its IUPAC name is 1-(2,2-dihydroxy-1,3-benzodioxol-5-yl)-2-(trihydroxymethylamino)propane-1,1,2-triol.
| Compound Name | 1-(2,2-dihydroxy-1,3-benzodioxol-5-yl)-2-(trihydroxymethylamino)propane-1,1,2-triol |
|---|---|
| PubChem CID | 170710318 |
| Molecular Formula | C11H15NO10 |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 1-(2,2-dihydroxy-1,3-benzodioxol-5-yl)-2-(trihydroxymethylamino)propane-1,1,2-triol |
| SMILES | CC(O)(NC(O)(O)O)C(O)(O)c1ccc2c(c1)OC(O)(O)O2 |
| InChI | InChI=1S/C11H15NO10/c1-8(13,12-10(16,17)18)9(14,15)5-2-3-6-7(4-5)22-11(19,20)21-6/h2-4,12-20H,1H3 |
| InChIKey | VXKNMZIURJZTHF-UHFFFAOYSA-N |
| XLogP | -3.92 |
| TPSA | 192.33 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|