C7H15O2PS4 — CID 170710447
hydroxy-methoxy-sulfanylidene-[(4R,5S)-3,3,5-trimethyldithiolan-4-yl]sulfanyl-λ5-phosphane (PubChem CID 170710447) has the molecular formula C7H15O2PS4 and a molecular weight of 290.44 g/mol. Its IUPAC name is hydroxy-methoxy-sulfanylidene-[(4R,5S)-3,3,5-trimethyldithiolan-4-yl]sulfanyl-λ5-phosphane.
| Compound Name | hydroxy-methoxy-sulfanylidene-[(4R,5S)-3,3,5-trimethyldithiolan-4-yl]sulfanyl-λ5-phosphane |
|---|---|
| PubChem CID | 170710447 |
| Molecular Formula | C7H15O2PS4 |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | hydroxy-methoxy-sulfanylidene-[(4R,5S)-3,3,5-trimethyldithiolan-4-yl]sulfanyl-λ5-phosphane |
| SMILES | COP(O)(=S)S[C@@H]1[C@H](C)SSC1(C)C |
| InChI | InChI=1S/C7H15O2PS4/c1-5-6(7(2,3)14-13-5)12-10(8,11)9-4/h5-6H,1-4H3,(H,8,11)/t5-,6+,10?/m0/s1 |
| InChIKey | ATRYZIILAXMWKD-HIJFXMFQSA-N |
| XLogP | 3.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|