About 4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane
4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane (PubChem CID 170710478) has the molecular formula C9H16OS2
and a molecular weight of 204.36 g/mol. Its IUPAC name is 4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane |
| PubChem CID | 170710478 |
| Molecular Formula | C9H16OS2 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane |
| SMILES | COC1C(C)SSC12CCCC2 |
| InChI | InChI=1S/C9H16OS2/c1-7-8(10-2)9(12-11-7)5-3-4-6-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | JBGYXNSQZINNTR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane?
The IUPAC name of 4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane (CID 170710478) is 4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane.
What is the SMILES notation for 4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane?
The canonical SMILES for 4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane is COC1C(C)SSC12CCCC2.
What is the InChIKey of 4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane?
The InChIKey is JBGYXNSQZINNTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OS2/c1-7-8(10-2)9(12-11-7)5-3-4-6-9/h7-8H,3-6H2,1-2H3.
What are the key properties of 4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane?
4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane has a molecular weight of 204.36 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3-methyl-1,2-dithiaspiro[4.4]nonane is sourced from PubChem (CID 170710478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).