About N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide
N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide (PubChem CID 170710846) has the molecular formula C19H22N2O3
and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide |
| PubChem CID | 170710846 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide |
| SMILES | COCCN(C(=O)c1ccc(C)cc1C)c1ccccc1C(N)=O |
| InChI | InChI=1S/C19H22N2O3/c1-13-8-9-15(14(2)12-13)19(23)21(10-11-24-3)17-7-5-4-6-16(17)18(20)22/h4-9,12H,10-11H2,1-3H3,(H2,20,22) |
| InChIKey | KAGLUGHZCAGKLR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide?
The IUPAC name of N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide (CID 170710846) is N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide.
What is the SMILES notation for N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide?
The canonical SMILES for N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide is COCCN(C(=O)c1ccc(C)cc1C)c1ccccc1C(N)=O.
What is the InChIKey of N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide?
The InChIKey is KAGLUGHZCAGKLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O3/c1-13-8-9-15(14(2)12-13)19(23)21(10-11-24-3)17-7-5-4-6-16(17)18(20)22/h4-9,12H,10-11H2,1-3H3,(H2,20,22).
What are the key properties of N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide?
N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide has a molecular weight of 326.40 g/mol, XLogP of 2.70, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-carbamoylphenyl)-N-(2-methoxyethyl)-2,4-dimethylbenzamide is sourced from PubChem (CID 170710846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).