C28H33N5O2S — CID 170710928
N-[[4-[4-amino-5-[4-(ethyl-oxo-propan-2-yl-λ6-sulfanylidene)cyclohexa-1,5-dien-1-yl]-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]prop-2-enamide (PubChem CID 170710928) has the molecular formula C28H33N5O2S and a molecular weight of 503.67 g/mol. Its IUPAC name is N-[[4-[4-amino-5-[4-(ethyl-oxo-propan-2-yl-λ6-sulfanylidene)cyclohexa-1,5-dien-1-yl]-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[4-[4-amino-5-[4-(ethyl-oxo-propan-2-yl-λ6-sulfanylidene)cyclohexa-1,5-dien-1-yl]-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 170710928 |
| Molecular Formula | C28H33N5O2S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | N-[[4-[4-amino-5-[4-(ethyl-oxo-propan-2-yl-λ6-sulfanylidene)cyclohexa-1,5-dien-1-yl]-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccc(-c2c(C3=CCC(=S(=O)(CC)C(C)C)C=C3)c3c(N)ncnc3n2C)cc1 |
| InChI | InChI=1S/C28H33N5O2S/c1-6-23(34)30-16-19-8-10-21(11-9-19)26-24(25-27(29)31-17-32-28(25)33(26)5)20-12-14-22(15-13-20)36(35,7-2)18(3)4/h6,8-14,17-18H,1,7,15-16H2,2-5H3,(H,30,34)(H2,29,31,32) |
| InChIKey | PGGCZFYMJPBBEC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|