About tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate
tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate (PubChem CID 170711416) has the molecular formula C15H23F3N4O2
and a molecular weight of 348.37 g/mol. Its IUPAC name is tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate |
| PubChem CID | 170711416 |
| Molecular Formula | C15H23F3N4O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate |
| SMILES | Cn1cc(C2CN(C(=O)OC(C)(C)C)CCN2CC(F)(F)F)cn1 |
| InChI | InChI=1S/C15H23F3N4O2/c1-14(2,3)24-13(23)21-5-6-22(10-15(16,17)18)12(9-21)11-7-19-20(4)8-11/h7-8,12H,5-6,9-10H2,1-4H3 |
| InChIKey | GALCMUZGJYNGLN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate?
The IUPAC name of tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate (CID 170711416) is tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate is Cn1cc(C2CN(C(=O)OC(C)(C)C)CCN2CC(F)(F)F)cn1.
What is the InChIKey of tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate?
The InChIKey is GALCMUZGJYNGLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F3N4O2/c1-14(2,3)24-13(23)21-5-6-22(10-15(16,17)18)12(9-21)11-7-19-20(4)8-11/h7-8,12H,5-6,9-10H2,1-4H3.
What are the key properties of tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate?
tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate has a molecular weight of 348.37 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(1-methylpyrazol-4-yl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate is sourced from PubChem (CID 170711416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).