About tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate
tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate (PubChem CID 170711585) has the molecular formula C15H24F2N4O2
and a molecular weight of 330.38 g/mol. Its IUPAC name is tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate |
| PubChem CID | 170711585 |
| Molecular Formula | C15H24F2N4O2 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate |
| SMILES | Cn1cc(C2CN(C(=O)OC(C)(C)C)CCN2CC(F)F)cn1 |
| InChI | InChI=1S/C15H24F2N4O2/c1-15(2,3)23-14(22)21-6-5-20(10-13(16)17)12(9-21)11-7-18-19(4)8-11/h7-8,12-13H,5-6,9-10H2,1-4H3 |
| InChIKey | BFZJKCDJIRUDEX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate (CID 170711585) is tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate is Cn1cc(C2CN(C(=O)OC(C)(C)C)CCN2CC(F)F)cn1.
What is the InChIKey of tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate?
The InChIKey is BFZJKCDJIRUDEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F2N4O2/c1-15(2,3)23-14(22)21-6-5-20(10-13(16)17)12(9-21)11-7-18-19(4)8-11/h7-8,12-13H,5-6,9-10H2,1-4H3.
What are the key properties of tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate?
tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate has a molecular weight of 330.38 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(2,2-difluoroethyl)-3-(1-methylpyrazol-4-yl)piperazine-1-carboxylate is sourced from PubChem (CID 170711585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).