C17H28N2O3 — CID 170712244
[(2E,4Z)-2-[(1Z)-buta-1,3-dienyl]hexa-2,4-dienyl] N-(2-acetamidoethyl)carbamate;ethane (PubChem CID 170712244) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is [(2E,4Z)-2-[(1Z)-buta-1,3-dienyl]hexa-2,4-dienyl] N-(2-acetamidoethyl)carbamate;ethane.
| Compound Name | [(2E,4Z)-2-[(1Z)-buta-1,3-dienyl]hexa-2,4-dienyl] N-(2-acetamidoethyl)carbamate;ethane |
|---|---|
| PubChem CID | 170712244 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | [(2E,4Z)-2-[(1Z)-buta-1,3-dienyl]hexa-2,4-dienyl] N-(2-acetamidoethyl)carbamate;ethane |
| SMILES | C=C/C=C\C(=C/C=C\C)COC(=O)NCCNC(C)=O.CC |
| InChI | InChI=1S/C15H22N2O3.C2H6/c1-4-6-8-14(9-7-5-2)12-20-15(19)17-11-10-16-13(3)18;1-2/h4-9H,1,10-12H2,2-3H3,(H,16,18)(H,17,19);1-2H3/b7-5-,8-6-,14-9+; |
| InChIKey | PFCTXNPYXFZNNR-PMSHBVJVSA-N |
| XLogP | 3.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|