About 1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane
1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane (PubChem CID 170712688) has the molecular formula C18H36O2
and a molecular weight of 284.48 g/mol. Its IUPAC name is 1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane |
| PubChem CID | 170712688 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | 1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane |
| SMILES | COCC(CCC(C)C)(COC)C1CC(C)CC(C)C1 |
| InChI | InChI=1S/C18H36O2/c1-14(2)7-8-18(12-19-5,13-20-6)17-10-15(3)9-16(4)11-17/h14-17H,7-13H2,1-6H3 |
| InChIKey | DYWCBSOFYZIQMH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane?
The IUPAC name of 1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane (CID 170712688) is 1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane.
What is the SMILES notation for 1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane?
The canonical SMILES for 1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane is COCC(CCC(C)C)(COC)C1CC(C)CC(C)C1.
What is the InChIKey of 1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane?
The InChIKey is DYWCBSOFYZIQMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2/c1-14(2)7-8-18(12-19-5,13-20-6)17-10-15(3)9-16(4)11-17/h14-17H,7-13H2,1-6H3.
What are the key properties of 1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane?
1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane has a molecular weight of 284.48 g/mol, XLogP of 4.77, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-methoxy-2-(methoxymethyl)-5-methylhexan-2-yl]-3,5-dimethylcyclohexane is sourced from PubChem (CID 170712688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).