C21H26O3S2 — CID 170714659
4,4-bis[(4-methylphenyl)sulfanyloxymethyl]oxane (PubChem CID 170714659) has the molecular formula C21H26O3S2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 4,4-bis[(4-methylphenyl)sulfanyloxymethyl]oxane.
| Compound Name | 4,4-bis[(4-methylphenyl)sulfanyloxymethyl]oxane |
|---|---|
| PubChem CID | 170714659 |
| Molecular Formula | C21H26O3S2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 4,4-bis[(4-methylphenyl)sulfanyloxymethyl]oxane |
| SMILES | Cc1ccc(SOCC2(COSc3ccc(C)cc3)CCOCC2)cc1 |
| InChI | InChI=1S/C21H26O3S2/c1-17-3-7-19(8-4-17)25-23-15-21(11-13-22-14-12-21)16-24-26-20-9-5-18(2)6-10-20/h3-10H,11-16H2,1-2H3 |
| InChIKey | DJDAXNSJQSSIDI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|