C14H14ClFN4OS — CID 170714972
(7S)-12-chloro-13-fluoro-16-methylsulfanyl-9-oxa-2,11,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene (PubChem CID 170714972) has the molecular formula C14H14ClFN4OS and a molecular weight of 340.81 g/mol. Its IUPAC name is (7S)-12-chloro-13-fluoro-16-methylsulfanyl-9-oxa-2,11,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene.
| Compound Name | (7S)-12-chloro-13-fluoro-16-methylsulfanyl-9-oxa-2,11,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene |
|---|---|
| PubChem CID | 170714972 |
| Molecular Formula | C14H14ClFN4OS |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (7S)-12-chloro-13-fluoro-16-methylsulfanyl-9-oxa-2,11,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene |
| SMILES | CSc1nc2c3c(nc(Cl)c(F)c3n1)OC[C@@H]1CCCCN21 |
| InChI | InChI=1S/C14H14ClFN4OS/c1-22-14-17-10-8-12(19-14)20-5-3-2-4-7(20)6-21-13(8)18-11(15)9(10)16/h7H,2-6H2,1H3/t7-/m0/s1 |
| InChIKey | LUGSFBHUCDTKQJ-ZETCQYMHSA-N |
| XLogP | 3.29 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|