About ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine
ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine (PubChem CID 170715036) has the molecular formula C8H18FN
and a molecular weight of 147.24 g/mol. Its IUPAC name is ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine.
Molecular Properties
| Compound Name | ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine |
| PubChem CID | 170715036 |
| Molecular Formula | C8H18FN |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.14 |
| IUPAC Name | ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine |
| SMILES | CC.C[C@@H]1CN(C)C[C@H]1F |
| InChI | InChI=1S/C6H12FN.C2H6/c1-5-3-8(2)4-6(5)7;1-2/h5-6H,3-4H2,1-2H3;1-2H3/t5-,6-;/m1./s1 |
| InChIKey | VVZLAWFYLDAOSY-KGZKBUQUSA-N |
| XLogP | 1.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine?
The IUPAC name of ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine (CID 170715036) is ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine.
What is the SMILES notation for ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine?
The canonical SMILES for ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine is CC.C[C@@H]1CN(C)C[C@H]1F.
What is the InChIKey of ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine?
The InChIKey is VVZLAWFYLDAOSY-KGZKBUQUSA-N. The full InChI is InChI=1S/C6H12FN.C2H6/c1-5-3-8(2)4-6(5)7;1-2/h5-6H,3-4H2,1-2H3;1-2H3/t5-,6-;/m1./s1.
What are the key properties of ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine?
ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine has a molecular weight of 147.24 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3S,4R)-3-fluoro-1,4-dimethylpyrrolidine is sourced from PubChem (CID 170715036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).