C14H16ClFN4O2S — CID 170715041
4-(7-chloro-8-fluoro-5-methoxy-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane (PubChem CID 170715041) has the molecular formula C14H16ClFN4O2S and a molecular weight of 358.83 g/mol. Its IUPAC name is 4-(7-chloro-8-fluoro-5-methoxy-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane.
| Compound Name | 4-(7-chloro-8-fluoro-5-methoxy-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane |
|---|---|
| PubChem CID | 170715041 |
| Molecular Formula | C14H16ClFN4O2S |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-(7-chloro-8-fluoro-5-methoxy-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepane |
| SMILES | COc1nc(Cl)c(F)c2nc(SC)nc(N3CCCOCC3)c12 |
| InChI | InChI=1S/C14H16ClFN4O2S/c1-21-13-8-10(9(16)11(15)18-13)17-14(23-2)19-12(8)20-4-3-6-22-7-5-20/h3-7H2,1-2H3 |
| InChIKey | WGMHORRDAQOKGK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|